C27H45NO3 — CID 142282043
2-[3-ethyl-4-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate;N-methylmethanamine (PubChem CID 142282043) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is 2-[3-ethyl-4-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate;N-methylmethanamine.
| Compound Name | 2-[3-ethyl-4-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate;N-methylmethanamine |
|---|---|
| PubChem CID | 142282043 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 2-[3-ethyl-4-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate;N-methylmethanamine |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C2CCC(CCCCC)CC2)c(CC)c1.CNC |
| InChI | InChI=1S/C25H38O3.C2H7N/c1-5-7-8-9-20-10-12-22(13-11-20)24-15-14-23(18-21(24)6-2)27-16-17-28-25(26)19(3)4;1-3-2/h14-15,18,20,22H,3,5-13,16-17H2,1-2,4H3;3H,1-2H3 |
| InChIKey | AEIOKFZCSXIZTG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|