C42H54O5 — CID 134246070
[4-[6-[3-ethyl-4-(4-hexylcyclohexyl)phenyl]naphthalen-2-yl]-3-(2-methylprop-2-enoyloxy)butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246070) has the molecular formula C42H54O5 and a molecular weight of 638.89 g/mol. Its IUPAC name is [4-[6-[3-ethyl-4-(4-hexylcyclohexyl)phenyl]naphthalen-2-yl]-3-(2-methylprop-2-enoyloxy)butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[6-[3-ethyl-4-(4-hexylcyclohexyl)phenyl]naphthalen-2-yl]-3-(2-methylprop-2-enoyloxy)butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246070 |
| Molecular Formula | C42H54O5 |
| Molecular Weight | 638.89 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | [4-[6-[3-ethyl-4-(4-hexylcyclohexyl)phenyl]naphthalen-2-yl]-3-(2-methylprop-2-enoyloxy)butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCOC(=O)C(=C)CO)Cc1ccc2cc(-c3ccc(C4CCC(CCCCCC)CC4)c(CC)c3)ccc2c1 |
| InChI | InChI=1S/C42H54O5/c1-6-8-9-10-11-31-12-15-34(16-13-31)40-21-20-38(26-33(40)7-2)37-19-18-35-24-32(14-17-36(35)27-37)25-39(47-41(44)29(3)4)22-23-46-42(45)30(5)28-43/h14,17-21,24,26-27,31,34,39,43H,3,5-13,15-16,22-23,25,28H2,1-2,4H3 |
| InChIKey | VDYHIQOCQMGZQD-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.89 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|