C33H44F2O4 — CID 138529148
[3-[3-fluoro-4-[3-fluoro-4-(4-hexylcyclohexyl)phenyl]phenyl]-4-methoxybutyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529148) has the molecular formula C33H44F2O4 and a molecular weight of 542.71 g/mol. Its IUPAC name is [3-[3-fluoro-4-[3-fluoro-4-(4-hexylcyclohexyl)phenyl]phenyl]-4-methoxybutyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[3-fluoro-4-[3-fluoro-4-(4-hexylcyclohexyl)phenyl]phenyl]-4-methoxybutyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529148 |
| Molecular Formula | C33H44F2O4 |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | [3-[3-fluoro-4-[3-fluoro-4-(4-hexylcyclohexyl)phenyl]phenyl]-4-methoxybutyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCC(COC)c1ccc(-c2ccc(C3CCC(CCCCCC)CC3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C33H44F2O4/c1-4-5-6-7-8-24-9-11-25(12-10-24)29-16-14-27(20-32(29)35)30-15-13-26(19-31(30)34)28(22-38-3)17-18-39-33(37)23(2)21-36/h13-16,19-20,24-25,28,36H,2,4-12,17-18,21-22H2,1,3H3 |
| InChIKey | UOITZCJFGYNUGN-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|