C30H43FO6 — CID 134246807
[2-[3-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246807) has the molecular formula C30H43FO6 and a molecular weight of 518.67 g/mol. Its IUPAC name is [2-[3-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[3-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246807 |
| Molecular Formula | C30H43FO6 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [2-[3-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)CO)c1ccc(CCC2CCC(CCCCC)CC2)c(F)c1 |
| InChI | InChI=1S/C30H43FO6/c1-4-5-6-7-23-8-10-24(11-9-23)12-13-25-14-15-26(16-28(25)31)27(19-36-29(34)21(2)17-32)20-37-30(35)22(3)18-33/h14-16,23-24,27,32-33H,2-13,17-20H2,1H3 |
| InChIKey | LNUJCQFINNPXMW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|