C36H52F2O5 — CID 134246600
[2-[2,3-difluoro-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246600) has the molecular formula C36H52F2O5 and a molecular weight of 602.80 g/mol. Its IUPAC name is [2-[2,3-difluoro-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[2,3-difluoro-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246600 |
| Molecular Formula | C36H52F2O5 |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | [2-[2,3-difluoro-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)c1ccc(CCC2CCC(C3CCC(CCCCC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C36H52F2O5/c1-5-6-7-8-26-9-14-28(15-10-26)29-16-11-27(12-17-29)13-18-30-19-20-32(34(38)33(30)37)31(22-42-35(40)24(2)3)23-43-36(41)25(4)21-39/h19-20,26-29,31,39H,2,4-18,21-23H2,1,3H3 |
| InChIKey | GKLPUQXTBVCGRO-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|