C30H42O7 — CID 134245052
[3-(2-methylprop-2-enoyloxy)-2-[4-[(Z)-2-(4-pentylcyclohexyl)oxyethenoxy]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245052) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-2-[4-[(Z)-2-(4-pentylcyclohexyl)oxyethenoxy]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[(Z)-2-(4-pentylcyclohexyl)oxyethenoxy]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245052 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[(Z)-2-(4-pentylcyclohexyl)oxyethenoxy]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)c1ccc(O/C=C\OC2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C30H42O7/c1-5-6-7-8-24-9-13-27(14-10-24)34-17-18-35-28-15-11-25(12-16-28)26(20-36-29(32)22(2)3)21-37-30(33)23(4)19-31/h11-12,15-18,24,26-27,31H,2,4-10,13-14,19-21H2,1,3H3/b18-17- |
| InChIKey | NOEMPSNPIXVWDN-ZCXUNETKSA-N |
| XLogP | 5.99 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|