C29H42O8 — CID 142282152
[4-[1-(3-hydroxy-2-methylpropanoyl)oxy-3-[2-(hydroxymethyl)prop-2-enoyloxy]propan-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 142282152) has the molecular formula C29H42O8 and a molecular weight of 518.65 g/mol. Its IUPAC name is [4-[1-(3-hydroxy-2-methylpropanoyl)oxy-3-[2-(hydroxymethyl)prop-2-enoyloxy]propan-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-[1-(3-hydroxy-2-methylpropanoyl)oxy-3-[2-(hydroxymethyl)prop-2-enoyloxy]propan-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142282152 |
| Molecular Formula | C29H42O8 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [4-[1-(3-hydroxy-2-methylpropanoyl)oxy-3-[2-(hydroxymethyl)prop-2-enoyloxy]propan-2-yl]phenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(C)CO)c1ccc(OC(=O)C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C29H42O8/c1-4-5-6-7-22-8-10-24(11-9-22)29(34)37-26-14-12-23(13-15-26)25(18-35-27(32)20(2)16-30)19-36-28(33)21(3)17-31/h12-15,21-22,24-25,30-31H,2,4-11,16-19H2,1,3H3 |
| InChIKey | ZHEKIVKUCRKOGG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|