C43H60O6 — CID 155029900
[3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 155029900) has the molecular formula C43H60O6 and a molecular weight of 672.95 g/mol. Its IUPAC name is [3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155029900 |
| Molecular Formula | C43H60O6 |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.44 |
| IUPAC Name | [3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)COC)c1ccc(CCc2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C43H60O6/c1-5-6-7-8-33-11-17-36(18-12-33)38-23-25-39(26-24-38)37-19-13-34(14-20-37)9-10-35-15-21-40(22-16-35)41(29-48-42(45)31(2)27-44)30-49-43(46)32(3)28-47-4/h13-16,19-22,33,36,38-39,41,44H,2-3,5-12,17-18,23-30H2,1,4H3 |
| InChIKey | PTACYDAQUZOCHC-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|