C37H49FO6 — CID 138711122
[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[2-(methoxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138711122) has the molecular formula C37H49FO6 and a molecular weight of 608.79 g/mol. Its IUPAC name is [4-[3-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[2-(methoxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[3-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[2-(methoxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138711122 |
| Molecular Formula | C37H49FO6 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | [4-[3-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[2-(methoxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCc1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)c(F)c1)COC(=O)C(=C)COC |
| InChI | InChI=1S/C37H49FO6/c1-5-6-7-8-28-11-14-31(15-12-28)32-16-18-33(19-17-32)34-20-13-29(21-35(34)38)9-10-30(24-43-36(40)26(2)22-39)25-44-37(41)27(3)23-42-4/h13,16-21,28,30-31,39H,2-3,5-12,14-15,22-25H2,1,4H3 |
| InChIKey | HYCADDCOYNGMIB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|