C42H51F3O6 — CID 145411920
[4-[4-[4-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-3-fluorophenyl]cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] (2S)-3-hydroxy-2-methylpropanoate (PubChem CID 145411920) has the molecular formula C42H51F3O6 and a molecular weight of 708.86 g/mol. Its IUPAC name is [4-[4-[4-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-3-fluorophenyl]cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] (2S)-3-hydroxy-2-methylpropanoate.
| Compound Name | [4-[4-[4-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-3-fluorophenyl]cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] (2S)-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 145411920 |
| Molecular Formula | C42H51F3O6 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.36 |
| IUPAC Name | [4-[4-[4-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-3-fluorophenyl]cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] (2S)-3-hydroxy-2-methylpropanoate |
| SMILES | C=C(CO)C(=O)OCC(CCC1CCC(c2ccc(-c3ccc(-c4ccc(CCCCC)cc4)c(F)c3F)c(F)c2)CC1)COC(=O)[C@@H](C)CO |
| InChI | InChI=1S/C42H51F3O6/c1-4-5-6-7-29-12-16-33(17-13-29)35-20-21-37(40(45)39(35)44)36-19-18-34(22-38(36)43)32-14-10-30(11-15-32)8-9-31(25-50-41(48)27(2)23-46)26-51-42(49)28(3)24-47/h12-13,16-22,28,30-32,46-47H,2,4-11,14-15,23-26H2,1,3H3/t28-,30?,31?,32?/m0/s1 |
| InChIKey | VRHPVYXZLMNQEF-HNBAYLHISA-N |
| XLogP | 9.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|