C39H48F2O3 — CID 134244814
[2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-3-fluorophenyl]-3-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 134244814) has the molecular formula C39H48F2O3 and a molecular weight of 602.81 g/mol. Its IUPAC name is [2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-3-fluorophenyl]-3-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-3-fluorophenyl]-3-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134244814 |
| Molecular Formula | C39H48F2O3 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | [2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-3-fluorophenyl]-3-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CC1CCC(c2ccc(-c3ccc(-c4ccc(CCCCC)c(CC)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C39H48F2O3/c1-5-7-8-9-30-14-15-33(21-29(30)6-2)35-19-17-34(23-38(35)41)36-18-16-32(22-37(36)40)31-12-10-27(11-13-31)20-28(24-42)25-44-39(43)26(3)4/h14-19,21-23,27-28,31,42H,3,5-13,20,24-25H2,1-2,4H3 |
| InChIKey | CDCGKFGQJFHMMJ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|