C36H51FO3 — CID 145411572
[2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] formate (PubChem CID 145411572) has the molecular formula C36H51FO3 and a molecular weight of 550.80 g/mol. Its IUPAC name is [2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] formate.
| Compound Name | [2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] formate |
|---|---|
| PubChem CID | 145411572 |
| Molecular Formula | C36H51FO3 |
| Molecular Weight | 550.80 g/mol |
| Exact Mass | 550.38 |
| IUPAC Name | [2-[[4-[4-[4-(3-ethyl-4-pentylphenyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] formate |
| SMILES | CCCCCc1ccc(-c2ccc(C3CCC(C4CCC(CC(CO)COC=O)CC4)CC3)c(F)c2)cc1CC |
| InChI | InChI=1S/C36H51FO3/c1-3-5-6-7-29-14-17-33(21-28(29)4-2)34-18-19-35(36(37)22-34)32-15-12-31(13-16-32)30-10-8-26(9-11-30)20-27(23-38)24-40-25-39/h14,17-19,21-22,25-27,30-32,38H,3-13,15-16,20,23-24H2,1-2H3 |
| InChIKey | CNCOCDFOZQVWOY-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.80 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|