C34H38F4O3 — CID 145411386
[2-[[4-[4-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] formate (PubChem CID 145411386) has the molecular formula C34H38F4O3 and a molecular weight of 570.67 g/mol. Its IUPAC name is [2-[[4-[4-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] formate.
| Compound Name | [2-[[4-[4-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] formate |
|---|---|
| PubChem CID | 145411386 |
| Molecular Formula | C34H38F4O3 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | [2-[[4-[4-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-fluorophenyl]cyclohexyl]methyl]-3-hydroxypropyl] formate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C4CCC(CC(CO)COC=O)CC4)c(F)c3)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C34H38F4O3/c1-2-3-4-5-25-10-15-30(34(38)33(25)37)27-12-14-29(32(36)18-27)26-11-13-28(31(35)17-26)24-8-6-22(7-9-24)16-23(19-39)20-41-21-40/h10-15,17-18,21-24,39H,2-9,16,19-20H2,1H3 |
| InChIKey | YBZKRXUZNNPZNW-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|