C24H27F3O — CID 126764663
5-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-ethenyloxane (PubChem CID 126764663) has the molecular formula C24H27F3O and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-ethenyloxane.
| Compound Name | 5-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-ethenyloxane |
|---|---|
| PubChem CID | 126764663 |
| Molecular Formula | C24H27F3O |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-2-ethenyloxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(CCCCC)c(F)c3F)cc2F)CO1 |
| InChI | InChI=1S/C24H27F3O/c1-3-5-6-7-16-9-13-21(24(27)23(16)26)17-10-12-20(22(25)14-17)18-8-11-19(4-2)28-15-18/h4,9-10,12-14,18-19H,2-3,5-8,11,15H2,1H3 |
| InChIKey | LSJNVEDLNLBOAF-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|