C30H31F3O — CID 67732645
2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-ethenyloxane (PubChem CID 67732645) has the molecular formula C30H31F3O and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-ethenyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-ethenyloxane |
|---|---|
| PubChem CID | 67732645 |
| Molecular Formula | C30H31F3O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-ethenyloxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(CCCCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C30H31F3O/c1-3-5-6-7-23-13-15-25(30(33)29(23)32)22-11-9-21(10-12-22)24-14-16-26(27(31)18-24)28-17-8-20(4-2)19-34-28/h4,9-16,18,20,28H,2-3,5-8,17,19H2,1H3 |
| InChIKey | SUZPZRJWMODASI-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|