C24H29F3O — CID 126764455
2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-5-ethyloxane (PubChem CID 126764455) has the molecular formula C24H29F3O and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-5-ethyloxane.
| Compound Name | 2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-5-ethyloxane |
|---|---|
| PubChem CID | 126764455 |
| Molecular Formula | C24H29F3O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]-5-ethyloxane |
| SMILES | CCCCCc1ccc(-c2ccc(C3CCC(CC)CO3)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C24H29F3O/c1-3-5-6-7-17-9-11-19(24(27)23(17)26)18-10-12-20(21(25)14-18)22-13-8-16(4-2)15-28-22/h9-12,14,16,22H,3-8,13,15H2,1-2H3 |
| InChIKey | RLNLJUDEEDSGNR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|