C30H33F3O — CID 143773009
2-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2-fluorophenyl]-5-methyloxane (PubChem CID 143773009) has the molecular formula C30H33F3O and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2-fluorophenyl]-5-methyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2-fluorophenyl]-5-methyloxane |
|---|---|
| PubChem CID | 143773009 |
| Molecular Formula | C30H33F3O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2-fluorophenyl]-5-methyloxane |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(C4CCC(C)CO4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C30H33F3O/c1-3-4-5-6-7-23-13-15-25(30(33)29(23)32)22-11-9-21(10-12-22)24-14-16-26(27(31)18-24)28-17-8-20(2)19-34-28/h9-16,18,20,28H,3-8,17,19H2,1-2H3 |
| InChIKey | KYRRWFFPOHDESL-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|