C36H43F3O — CID 67732692
2-[4-[4-[2,3-difluoro-4-[(Z)-hex-4-enyl]phenyl]phenyl]-2-fluorophenyl]-5-heptyloxane (PubChem CID 67732692) has the molecular formula C36H43F3O and a molecular weight of 548.73 g/mol. Its IUPAC name is 2-[4-[4-[2,3-difluoro-4-[(Z)-hex-4-enyl]phenyl]phenyl]-2-fluorophenyl]-5-heptyloxane.
| Compound Name | 2-[4-[4-[2,3-difluoro-4-[(Z)-hex-4-enyl]phenyl]phenyl]-2-fluorophenyl]-5-heptyloxane |
|---|---|
| PubChem CID | 67732692 |
| Molecular Formula | C36H43F3O |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 2-[4-[4-[2,3-difluoro-4-[(Z)-hex-4-enyl]phenyl]phenyl]-2-fluorophenyl]-5-heptyloxane |
| SMILES | C/C=C\CCCc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCCCC)CO4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C36H43F3O/c1-3-5-7-9-10-12-26-14-23-34(40-25-26)32-22-20-30(24-33(32)37)27-15-17-28(18-16-27)31-21-19-29(35(38)36(31)39)13-11-8-6-4-2/h4,6,15-22,24,26,34H,3,5,7-14,23,25H2,1-2H3/b6-4- |
| InChIKey | QLCHHGKIXJOQAU-XQRVVYSFSA-N |
| XLogP | 11.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|