C29H29F3O — CID 67732623
2-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]oxane (PubChem CID 67732623) has the molecular formula C29H29F3O and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]oxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]oxane |
|---|---|
| PubChem CID | 67732623 |
| Molecular Formula | C29H29F3O |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]oxane |
| SMILES | C/C=C/CCC1CCC(c2ccc(-c3ccc(-c4ccc(C)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C29H29F3O/c1-3-4-5-6-20-8-16-27(33-18-20)25-15-13-23(17-26(25)30)21-9-11-22(12-10-21)24-14-7-19(2)28(31)29(24)32/h3-4,7,9-15,17,20,27H,5-6,8,16,18H2,1-2H3/b4-3+ |
| InChIKey | LSNCYWNWXMJBSO-ONEGZZNKSA-N |
| XLogP | 8.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|