C32H34F4O — CID 67733078
5-butyl-2-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorophenyl]oxane (PubChem CID 67733078) has the molecular formula C32H34F4O and a molecular weight of 510.62 g/mol. Its IUPAC name is 5-butyl-2-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-butyl-2-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 67733078 |
| Molecular Formula | C32H34F4O |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 5-butyl-2-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorophenyl]oxane |
| SMILES | C/C=C/CCc1ccc(-c2ccc(-c3ccc(C4CCC(CCCC)CO4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C32H34F4O/c1-3-5-7-9-24-15-16-25(30(34)29(24)33)22-11-13-23(14-12-22)26-17-18-27(32(36)31(26)35)28-19-10-21(20-37-28)8-6-4-2/h3,5,11-18,21,28H,4,6-10,19-20H2,1-2H3/b5-3+ |
| InChIKey | JGTHKLRGODOLKG-HWKANZROSA-N |
| XLogP | 9.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|