C35H40F4O2 — CID 67732866
2-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-2,3-difluorophenyl]-5-[[(E)-prop-1-enoxy]methyl]oxane (PubChem CID 67732866) has the molecular formula C35H40F4O2 and a molecular weight of 568.70 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-2,3-difluorophenyl]-5-[[(E)-prop-1-enoxy]methyl]oxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-2,3-difluorophenyl]-5-[[(E)-prop-1-enoxy]methyl]oxane |
|---|---|
| PubChem CID | 67732866 |
| Molecular Formula | C35H40F4O2 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-2,3-difluorophenyl]-5-[[(E)-prop-1-enoxy]methyl]oxane |
| SMILES | C/C=C/OCC1CCC(c2ccc(-c3ccc(-c4ccc(CCCCCCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C35H40F4O2/c1-3-5-6-7-8-9-10-27-16-17-28(33(37)32(27)36)25-12-14-26(15-13-25)29-18-19-30(35(39)34(29)38)31-20-11-24(23-41-31)22-40-21-4-2/h4,12-19,21,24,31H,3,5-11,20,22-23H2,1-2H3/b21-4+ |
| InChIKey | KQRBNQVFECOOJT-IPBDZQFASA-N |
| XLogP | 10.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|