C31H32F4O — CID 67732985
5-but-3-enyl-2-[4-[4-(4-butyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane (PubChem CID 67732985) has the molecular formula C31H32F4O and a molecular weight of 496.59 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-(4-butyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-(4-butyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 67732985 |
| Molecular Formula | C31H32F4O |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-(4-butyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane |
| SMILES | C=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(CCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C31H32F4O/c1-3-5-7-20-9-18-27(36-19-20)26-17-16-25(30(34)31(26)35)22-12-10-21(11-13-22)24-15-14-23(8-6-4-2)28(32)29(24)33/h3,10-17,20,27H,1,4-9,18-19H2,2H3 |
| InChIKey | ZVXPDMGOJSOEIN-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|