C30H30F4O — CID 58535609
5-but-3-enyl-2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]oxane (PubChem CID 58535609) has the molecular formula C30H30F4O and a molecular weight of 482.56 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 58535609 |
| Molecular Formula | C30H30F4O |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 5-but-3-enyl-2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]oxane |
| SMILES | C=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(CCC)cc4)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C30H30F4O/c1-3-5-7-20-10-17-26(35-18-20)25-16-15-24(29(33)30(25)34)23-14-13-22(27(31)28(23)32)21-11-8-19(6-4-2)9-12-21/h3,8-9,11-16,20,26H,1,4-7,10,17-18H2,2H3 |
| InChIKey | XOCKZSFXAXKPHT-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|