C31H38F4O2 — CID 58535518
5-but-3-enyl-2-[2-[4-[2,3-difluoro-4-(6-propyloxan-3-yl)phenyl]-2,3-difluorophenyl]ethyl]oxane (PubChem CID 58535518) has the molecular formula C31H38F4O2 and a molecular weight of 518.64 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[4-[2,3-difluoro-4-(6-propyloxan-3-yl)phenyl]-2,3-difluorophenyl]ethyl]oxane.
| Compound Name | 5-but-3-enyl-2-[2-[4-[2,3-difluoro-4-(6-propyloxan-3-yl)phenyl]-2,3-difluorophenyl]ethyl]oxane |
|---|---|
| PubChem CID | 58535518 |
| Molecular Formula | C31H38F4O2 |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 5-but-3-enyl-2-[2-[4-[2,3-difluoro-4-(6-propyloxan-3-yl)phenyl]-2,3-difluorophenyl]ethyl]oxane |
| SMILES | C=CCCC1CCC(CCc2ccc(-c3ccc(C4CCC(CCC)OC4)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C31H38F4O2/c1-3-5-7-20-8-12-24(36-18-20)13-9-21-11-15-26(30(34)28(21)32)27-17-16-25(29(33)31(27)35)22-10-14-23(6-4-2)37-19-22/h3,11,15-17,20,22-24H,1,4-10,12-14,18-19H2,2H3 |
| InChIKey | MBCDJTXTRYFTEJ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|