C30H36F4O2 — CID 76816050
2-[4-[2,3-difluoro-4-[2-(5-prop-1-enyloxan-2-yl)ethyl]phenyl]-2,3-difluorophenyl]-5-propyloxane (PubChem CID 76816050) has the molecular formula C30H36F4O2 and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-[4-[2,3-difluoro-4-[2-(5-prop-1-enyloxan-2-yl)ethyl]phenyl]-2,3-difluorophenyl]-5-propyloxane.
| Compound Name | 2-[4-[2,3-difluoro-4-[2-(5-prop-1-enyloxan-2-yl)ethyl]phenyl]-2,3-difluorophenyl]-5-propyloxane |
|---|---|
| PubChem CID | 76816050 |
| Molecular Formula | C30H36F4O2 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-[4-[2,3-difluoro-4-[2-(5-prop-1-enyloxan-2-yl)ethyl]phenyl]-2,3-difluorophenyl]-5-propyloxane |
| SMILES | CC=CC1CCC(CCc2ccc(-c3ccc(C4CCC(CCC)CO4)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C30H36F4O2/c1-3-5-19-7-11-22(35-17-19)12-9-21-10-13-23(28(32)27(21)31)24-14-15-25(30(34)29(24)33)26-16-8-20(6-4-2)18-36-26/h3,5,10,13-15,19-20,22,26H,4,6-9,11-12,16-18H2,1-2H3 |
| InChIKey | WNGHHXWQCXWVBW-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|