C28H32F4O2 — CID 76816033
2-[4-[2,3-difluoro-4-(6-prop-1-enyloxan-3-yl)phenyl]-2,3-difluorophenyl]-5-propyloxane (PubChem CID 76816033) has the molecular formula C28H32F4O2 and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-[4-[2,3-difluoro-4-(6-prop-1-enyloxan-3-yl)phenyl]-2,3-difluorophenyl]-5-propyloxane.
| Compound Name | 2-[4-[2,3-difluoro-4-(6-prop-1-enyloxan-3-yl)phenyl]-2,3-difluorophenyl]-5-propyloxane |
|---|---|
| PubChem CID | 76816033 |
| Molecular Formula | C28H32F4O2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[4-[2,3-difluoro-4-(6-prop-1-enyloxan-3-yl)phenyl]-2,3-difluorophenyl]-5-propyloxane |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(C4CCC(CCC)CO4)c(F)c3F)c(F)c2F)CO1 |
| InChI | InChI=1S/C28H32F4O2/c1-3-5-17-7-14-24(34-15-17)23-13-12-22(27(31)28(23)32)21-11-10-20(25(29)26(21)30)18-8-9-19(6-4-2)33-16-18/h4,6,10-13,17-19,24H,3,5,7-9,14-16H2,1-2H3 |
| InChIKey | MAUNBHXDOCELEL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|