C28H26F4O — CID 77344348
5-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane (PubChem CID 77344348) has the molecular formula C28H26F4O and a molecular weight of 454.51 g/mol. Its IUPAC name is 5-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane.
| Compound Name | 5-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane |
|---|---|
| PubChem CID | 77344348 |
| Molecular Formula | C28H26F4O |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 5-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(-c4ccc(CC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C28H26F4O/c1-3-5-21-12-10-20(16-33-21)24-15-14-23(27(31)28(24)32)19-8-6-18(7-9-19)22-13-11-17(4-2)25(29)26(22)30/h3,5-9,11,13-15,20-21H,4,10,12,16H2,1-2H3 |
| InChIKey | GQHQJLWXKUNZDA-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|