C22H24F2O2 — CID 91109331
5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-prop-1-enyloxane (PubChem CID 91109331) has the molecular formula C22H24F2O2 and a molecular weight of 358.43 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-prop-1-enyloxane.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-prop-1-enyloxane |
|---|---|
| PubChem CID | 91109331 |
| Molecular Formula | C22H24F2O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-prop-1-enyloxane |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)CO1 |
| InChI | InChI=1S/C22H24F2O2/c1-3-5-18-11-10-17(14-26-18)15-6-8-16(9-7-15)19-12-13-20(25-4-2)22(24)21(19)23/h3,5-9,12-13,17-18H,4,10-11,14H2,1-2H3 |
| InChIKey | QIONROGKWNPXCE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|