C36H48F2O2 — CID 91577408
5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]oxane (PubChem CID 91577408) has the molecular formula C36H48F2O2 and a molecular weight of 550.77 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]oxane.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 91577408 |
| Molecular Formula | C36H48F2O2 |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]oxane |
| SMILES | CC=CCCC1CCC(C2CCC(C3CCC(c4ccc(-c5ccc(OCC)c(F)c5F)cc4)CO3)CC2)CC1 |
| InChI | InChI=1S/C36H48F2O2/c1-3-5-6-7-25-8-10-26(11-9-25)27-14-18-30(19-15-27)33-22-20-31(24-40-33)28-12-16-29(17-13-28)32-21-23-34(39-4-2)36(38)35(32)37/h3,5,12-13,16-17,21,23,25-27,30-31,33H,4,6-11,14-15,18-20,22,24H2,1-2H3 |
| InChIKey | VKMWQTKRUNTJFA-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|