C36H42F2O2 — CID 91216721
5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]cyclohexyl]-2-pent-3-enyloxane (PubChem CID 91216721) has the molecular formula C36H42F2O2 and a molecular weight of 544.73 g/mol. Its IUPAC name is 5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]cyclohexyl]-2-pent-3-enyloxane.
| Compound Name | 5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]cyclohexyl]-2-pent-3-enyloxane |
|---|---|
| PubChem CID | 91216721 |
| Molecular Formula | C36H42F2O2 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]cyclohexyl]-2-pent-3-enyloxane |
| SMILES | CC=CCCC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCC)c(F)c5F)cc4)cc3)CC2)CO1 |
| InChI | InChI=1S/C36H42F2O2/c1-3-5-6-7-32-21-20-31(24-40-32)29-14-12-27(13-15-29)25-8-10-26(11-9-25)28-16-18-30(19-17-28)33-22-23-34(39-4-2)36(38)35(33)37/h3,5,8-11,16-19,22-23,27,29,31-32H,4,6-7,12-15,20-21,24H2,1-2H3 |
| InChIKey | XFRGJFARLWANDL-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|