C36H54F2O2 — CID 58021312
5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane (PubChem CID 58021312) has the molecular formula C36H54F2O2 and a molecular weight of 556.82 g/mol. Its IUPAC name is 5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane.
| Compound Name | 5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane |
|---|---|
| PubChem CID | 58021312 |
| Molecular Formula | C36H54F2O2 |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | 5-[4-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(C4CCC(c5ccc(OCC)c(F)c5F)CC4)CC3)CC2)CO1 |
| InChI | InChI=1S/C36H54F2O2/c1-3-5-6-7-32-21-20-31(24-40-32)29-14-12-27(13-15-29)25-8-10-26(11-9-25)28-16-18-30(19-17-28)33-22-23-34(39-4-2)36(38)35(33)37/h3,5,22-23,25-32H,4,6-21,24H2,1-2H3/b5-3+ |
| InChIKey | YKOVQUNVSQJFLS-HWKANZROSA-N |
| XLogP | 10.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|