C23H32F2O2 — CID 90801005
5-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]-2-pent-3-enyloxane (PubChem CID 90801005) has the molecular formula C23H32F2O2 and a molecular weight of 378.50 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]-2-pent-3-enyloxane.
| Compound Name | 5-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]-2-pent-3-enyloxane |
|---|---|
| PubChem CID | 90801005 |
| Molecular Formula | C23H32F2O2 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]-2-pent-3-enyloxane |
| SMILES | CC=CCCC1CCC(C2CCC(c3ccc(OC)c(F)c3F)CC2)CO1 |
| InChI | InChI=1S/C23H32F2O2/c1-3-4-5-6-19-12-11-18(15-27-19)16-7-9-17(10-8-16)20-13-14-21(26-2)23(25)22(20)24/h3-4,13-14,16-19H,5-12,15H2,1-2H3 |
| InChIKey | LVYVYVIHBGOGMI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|