C37H43F3O — CID 67738001
1-ethoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]benzene (PubChem CID 67738001) has the molecular formula C37H43F3O and a molecular weight of 560.74 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 67738001 |
| Molecular Formula | C37H43F3O |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[3-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]benzene |
| SMILES | C/C=C/CCC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCC)c(F)c5F)cc4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C37H43F3O/c1-3-5-6-7-25-8-10-26(11-9-25)27-12-16-29(17-13-27)32-21-20-31(24-34(32)38)28-14-18-30(19-15-28)33-22-23-35(41-4-2)37(40)36(33)39/h3,5,14-15,18-27,29H,4,6-13,16-17H2,1-2H3/b5-3+ |
| InChIKey | BAEDGJDUMFBKAI-HWKANZROSA-N |
| XLogP | 11.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|