C29H29F3O3 — CID 67734972
2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 67734972) has the molecular formula C29H29F3O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67734972 |
| Molecular Formula | C29H29F3O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C29H29F3O3/c1-3-5-6-7-19-17-34-29(35-18-19)24-13-12-22(16-25(24)30)20-8-10-21(11-9-20)23-14-15-26(33-4-2)28(32)27(23)31/h3,5,8-16,19,29H,4,6-7,17-18H2,1-2H3/b5-3+ |
| InChIKey | RPKGAEBJVFUKMH-HWKANZROSA-N |
| XLogP | 7.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|