C28H25BF4O3 — CID 88998380
CID 88998380 (PubChem CID 88998380) has the molecular formula C28H25BF4O3 and a molecular weight of 496.31 g/mol.
| Compound Name | CID 88998380 |
|---|---|
| PubChem CID | 88998380 |
| Molecular Formula | C28H25BF4O3 |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc(-c2ccc(-c3ccc(C4OCC(CC/C=C/C)CO4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H25BF4O3/c1-2-3-4-5-17-14-34-28(35-15-17)22-11-10-20(24(30)26(22)32)18-6-8-19(9-7-18)21-12-13-23(36-16-29)27(33)25(21)31/h2-3,6-13,17,28H,4-5,14-16H2,1H3/b3-2+ |
| InChIKey | YINDCKDVQCUJCB-NSCUHMNNSA-N |
| XLogP | 7.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|