C35H41F3O3 — CID 67734984
2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 67734984) has the molecular formula C35H41F3O3 and a molecular weight of 566.70 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67734984 |
| Molecular Formula | C35H41F3O3 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2ccc(-c3ccc(-c4ccc(OCCCCCCCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C35H41F3O3/c1-3-5-7-8-9-11-21-39-32-20-19-29(33(37)34(32)38)27-15-13-26(14-16-27)28-17-18-30(31(36)22-28)35-40-23-25(24-41-35)12-10-6-4-2/h4,6,13-20,22,25,35H,3,5,7-12,21,23-24H2,1-2H3/b6-4+ |
| InChIKey | AKSTUHVLMBQPSZ-GQCTYLIASA-N |
| XLogP | 10.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|