C30H31F3O3 — CID 77345138
5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane (PubChem CID 77345138) has the molecular formula C30H31F3O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 77345138 |
| Molecular Formula | C30H31F3O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane |
| SMILES | CC=CC1OCC(c2ccc(-c3ccc(-c4ccc(OCCCCC)c(F)c4F)cc3)cc2F)CO1 |
| InChI | InChI=1S/C30H31F3O3/c1-3-5-6-16-34-27-15-14-25(29(32)30(27)33)21-10-8-20(9-11-21)22-12-13-24(26(31)17-22)23-18-35-28(7-4-2)36-19-23/h4,7-15,17,23,28H,3,5-6,16,18-19H2,1-2H3 |
| InChIKey | LWNQGYHOXABESH-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|