C26H23F3O3 — CID 77345099
5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane (PubChem CID 77345099) has the molecular formula C26H23F3O3 and a molecular weight of 440.46 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 77345099 |
| Molecular Formula | C26H23F3O3 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-2-prop-1-enyl-1,3-dioxane |
| SMILES | CC=CC1OCC(c2ccc(-c3ccc(-c4ccc(OC)c(F)c4F)cc3)cc2F)CO1 |
| InChI | InChI=1S/C26H23F3O3/c1-3-4-24-31-14-19(15-32-24)20-10-9-18(13-22(20)27)16-5-7-17(8-6-16)21-11-12-23(30-2)26(29)25(21)28/h3-13,19,24H,14-15H2,1-2H3 |
| InChIKey | PFYDEVGITWZDON-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|