C27H25F3O3 — CID 67736785
2-but-3-enyl-5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-1,3-dioxane (PubChem CID 67736785) has the molecular formula C27H25F3O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-but-3-enyl-5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-1,3-dioxane.
| Compound Name | 2-but-3-enyl-5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67736785 |
| Molecular Formula | C27H25F3O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-but-3-enyl-5-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-2-fluorophenyl]-1,3-dioxane |
| SMILES | C=CCCC1OCC(c2ccc(-c3ccc(-c4ccc(OC)c(F)c4F)cc3)cc2F)CO1 |
| InChI | InChI=1S/C27H25F3O3/c1-3-4-5-25-32-15-20(16-33-25)21-11-10-19(14-23(21)28)17-6-8-18(9-7-17)22-12-13-24(31-2)27(30)26(22)29/h3,6-14,20,25H,1,4-5,15-16H2,2H3 |
| InChIKey | JLFILFJCLMAFQH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|