C30H32BF3O3 — CID 88998320
CID 88998320 (PubChem CID 88998320) has the molecular formula C30H32BF3O3 and a molecular weight of 508.39 g/mol.
| Compound Name | CID 88998320 |
|---|---|
| PubChem CID | 88998320 |
| Molecular Formula | C30H32BF3O3 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc(-c2ccc(-c3ccc(C4COC(CCCCCCC)OC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C30H32BF3O3/c1-2-3-4-5-6-7-28-35-17-23(18-36-28)24-13-12-22(16-26(24)32)20-8-10-21(11-9-20)25-14-15-27(37-19-31)30(34)29(25)33/h8-16,23,28H,2-7,17-19H2,1H3 |
| InChIKey | XIGOPFLYYZKBLE-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|