C36H43F5O4 — CID 67741046
5-[[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenoxy]-difluoromethyl]-2-pentyl-1,3-dioxane (PubChem CID 67741046) has the molecular formula C36H43F5O4 and a molecular weight of 634.73 g/mol. Its IUPAC name is 5-[[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenoxy]-difluoromethyl]-2-pentyl-1,3-dioxane.
| Compound Name | 5-[[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenoxy]-difluoromethyl]-2-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 67741046 |
| Molecular Formula | C36H43F5O4 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 5-[[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2-fluorophenoxy]-difluoromethyl]-2-pentyl-1,3-dioxane |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(OC(F)(F)C4COC(CCCCC)OC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C36H43F5O4/c1-3-5-7-8-9-11-21-42-32-20-18-29(34(38)35(32)39)26-15-13-25(14-16-26)27-17-19-31(30(37)22-27)45-36(40,41)28-23-43-33(44-24-28)12-10-6-4-2/h13-20,22,28,33H,3-12,21,23-24H2,1-2H3 |
| InChIKey | DZGPDGNAUNSAIM-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|