C31H33F5O3 — CID 67741049
5-[[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-pentyloxane (PubChem CID 67741049) has the molecular formula C31H33F5O3 and a molecular weight of 548.59 g/mol. Its IUPAC name is 5-[[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-pentyloxane.
| Compound Name | 5-[[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-pentyloxane |
|---|---|
| PubChem CID | 67741049 |
| Molecular Formula | C31H33F5O3 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 5-[[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-pentyloxane |
| SMILES | CCCCCC1CCC(C(F)(F)Oc2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C31H33F5O3/c1-3-5-6-7-23-13-12-22(19-38-23)31(35,36)39-24-14-15-25(27(32)18-24)20-8-10-21(11-9-20)26-16-17-28(37-4-2)30(34)29(26)33/h8-11,14-18,22-23H,3-7,12-13,19H2,1-2H3 |
| InChIKey | YSHGQWOEYUZPFG-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|