C31H35F3O2 — CID 67733137
5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-pentyloxane (PubChem CID 67733137) has the molecular formula C31H35F3O2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-pentyloxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-pentyloxane |
|---|---|
| PubChem CID | 67733137 |
| Molecular Formula | C31H35F3O2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-pentyloxane |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(OCCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C31H35F3O2/c1-3-5-6-7-25-14-12-24(20-36-25)23-13-15-26(28(32)19-23)21-8-10-22(11-9-21)27-16-17-29(35-18-4-2)31(34)30(27)33/h8-11,13,15-17,19,24-25H,3-7,12,14,18,20H2,1-2H3 |
| InChIKey | JMTBAGGSXYHLEH-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|