C32H37F3O3 — CID 67736030
5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-heptyl-1,3-dioxane (PubChem CID 67736030) has the molecular formula C32H37F3O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-heptyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-heptyl-1,3-dioxane |
|---|---|
| PubChem CID | 67736030 |
| Molecular Formula | C32H37F3O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-3-fluorophenyl]-2-heptyl-1,3-dioxane |
| SMILES | CCCCCCCC1OCC(c2ccc(-c3ccc(-c4ccc(OCCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C32H37F3O3/c1-3-5-6-7-8-9-30-37-20-25(21-38-30)24-14-15-26(28(33)19-24)22-10-12-23(13-11-22)27-16-17-29(36-18-4-2)32(35)31(27)34/h10-17,19,25,30H,3-9,18,20-21H2,1-2H3 |
| InChIKey | HIEKKJARRVMQCL-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|