C32H35F3O3 — CID 67736323
5-[4-[4-[4-[(Z)-but-1-enoxy]-2,3-difluorophenyl]phenyl]-3-fluorophenyl]-2-hexyl-1,3-dioxane (PubChem CID 67736323) has the molecular formula C32H35F3O3 and a molecular weight of 524.62 g/mol. Its IUPAC name is 5-[4-[4-[4-[(Z)-but-1-enoxy]-2,3-difluorophenyl]phenyl]-3-fluorophenyl]-2-hexyl-1,3-dioxane.
| Compound Name | 5-[4-[4-[4-[(Z)-but-1-enoxy]-2,3-difluorophenyl]phenyl]-3-fluorophenyl]-2-hexyl-1,3-dioxane |
|---|---|
| PubChem CID | 67736323 |
| Molecular Formula | C32H35F3O3 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 5-[4-[4-[4-[(Z)-but-1-enoxy]-2,3-difluorophenyl]phenyl]-3-fluorophenyl]-2-hexyl-1,3-dioxane |
| SMILES | CC/C=C\Oc1ccc(-c2ccc(-c3ccc(C4COC(CCCCCC)OC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C32H35F3O3/c1-3-5-7-8-9-30-37-20-25(21-38-30)24-14-15-26(28(33)19-24)22-10-12-23(13-11-22)27-16-17-29(32(35)31(27)34)36-18-6-4-2/h6,10-19,25,30H,3-5,7-9,20-21H2,1-2H3/b18-6- |
| InChIKey | HZFMYMNAJHCRNL-FXBPXSCXSA-N |
| XLogP | 9.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|