C25H31F3O2 — CID 126765439
5-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]-2-hexyloxane (PubChem CID 126765439) has the molecular formula C25H31F3O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]-2-hexyloxane.
| Compound Name | 5-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]-2-hexyloxane |
|---|---|
| PubChem CID | 126765439 |
| Molecular Formula | C25H31F3O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 5-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]-2-hexyloxane |
| SMILES | CCCCCCC1CCC(c2ccc(-c3ccc(OCC)c(F)c3)c(F)c2F)CO1 |
| InChI | InChI=1S/C25H31F3O2/c1-3-5-6-7-8-19-11-9-18(16-30-19)21-13-12-20(24(27)25(21)28)17-10-14-23(29-4-2)22(26)15-17/h10,12-15,18-19H,3-9,11,16H2,1-2H3 |
| InChIKey | BFNIUXQMRLDSST-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|