C24H29F3O2 — CID 126765450
5-[2,3-difluoro-4-(3-fluoro-4-methoxyphenyl)phenyl]-2-hexyloxane (PubChem CID 126765450) has the molecular formula C24H29F3O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-[2,3-difluoro-4-(3-fluoro-4-methoxyphenyl)phenyl]-2-hexyloxane.
| Compound Name | 5-[2,3-difluoro-4-(3-fluoro-4-methoxyphenyl)phenyl]-2-hexyloxane |
|---|---|
| PubChem CID | 126765450 |
| Molecular Formula | C24H29F3O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-[2,3-difluoro-4-(3-fluoro-4-methoxyphenyl)phenyl]-2-hexyloxane |
| SMILES | CCCCCCC1CCC(c2ccc(-c3ccc(OC)c(F)c3)c(F)c2F)CO1 |
| InChI | InChI=1S/C24H29F3O2/c1-3-4-5-6-7-18-10-8-17(15-29-18)20-12-11-19(23(26)24(20)27)16-9-13-22(28-2)21(25)14-16/h9,11-14,17-18H,3-8,10,15H2,1-2H3 |
| InChIKey | LNOLVQCJUQFVNO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|