C25H31F3O3 — CID 126765460
5-[2,3-difluoro-4-(3-fluoro-4-propoxyphenyl)phenyl]-2-pentoxyoxane (PubChem CID 126765460) has the molecular formula C25H31F3O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-[2,3-difluoro-4-(3-fluoro-4-propoxyphenyl)phenyl]-2-pentoxyoxane.
| Compound Name | 5-[2,3-difluoro-4-(3-fluoro-4-propoxyphenyl)phenyl]-2-pentoxyoxane |
|---|---|
| PubChem CID | 126765460 |
| Molecular Formula | C25H31F3O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 5-[2,3-difluoro-4-(3-fluoro-4-propoxyphenyl)phenyl]-2-pentoxyoxane |
| SMILES | CCCCCOC1CCC(c2ccc(-c3ccc(OCCC)c(F)c3)c(F)c2F)CO1 |
| InChI | InChI=1S/C25H31F3O3/c1-3-5-6-14-30-23-12-8-18(16-31-23)20-10-9-19(24(27)25(20)28)17-7-11-22(21(26)15-17)29-13-4-2/h7,9-11,15,18,23H,3-6,8,12-14,16H2,1-2H3 |
| InChIKey | UFMOATIJAZAAFX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|