C26H33F3O2 — CID 126765463
5-[4-(4-butyl-3-fluorophenyl)-2,3-difluorophenyl]-2-pentoxyoxane (PubChem CID 126765463) has the molecular formula C26H33F3O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[4-(4-butyl-3-fluorophenyl)-2,3-difluorophenyl]-2-pentoxyoxane.
| Compound Name | 5-[4-(4-butyl-3-fluorophenyl)-2,3-difluorophenyl]-2-pentoxyoxane |
|---|---|
| PubChem CID | 126765463 |
| Molecular Formula | C26H33F3O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 5-[4-(4-butyl-3-fluorophenyl)-2,3-difluorophenyl]-2-pentoxyoxane |
| SMILES | CCCCCOC1CCC(c2ccc(-c3ccc(CCCC)c(F)c3)c(F)c2F)CO1 |
| InChI | InChI=1S/C26H33F3O2/c1-3-5-7-15-30-24-14-11-20(17-31-24)22-13-12-21(25(28)26(22)29)19-10-9-18(8-6-4-2)23(27)16-19/h9-10,12-13,16,20,24H,3-8,11,14-15,17H2,1-2H3 |
| InChIKey | MTGNQUQQYNZSHC-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|