C21H23F3O2 — CID 126764630
5-[4-(2,3-difluoro-4-methylphenyl)-2-fluorophenyl]-2-propoxyoxane (PubChem CID 126764630) has the molecular formula C21H23F3O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-methylphenyl)-2-fluorophenyl]-2-propoxyoxane.
| Compound Name | 5-[4-(2,3-difluoro-4-methylphenyl)-2-fluorophenyl]-2-propoxyoxane |
|---|---|
| PubChem CID | 126764630 |
| Molecular Formula | C21H23F3O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-methylphenyl)-2-fluorophenyl]-2-propoxyoxane |
| SMILES | CCCOC1CCC(c2ccc(-c3ccc(C)c(F)c3F)cc2F)CO1 |
| InChI | InChI=1S/C21H23F3O2/c1-3-10-25-19-9-6-15(12-26-19)16-8-5-14(11-18(16)22)17-7-4-13(2)20(23)21(17)24/h4-5,7-8,11,15,19H,3,6,9-10,12H2,1-2H3 |
| InChIKey | YESBBJLBJHIPFM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |